C24H18ClN5O — CID 3778846
9-(3-chlorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 3778846) has the molecular formula C24H18ClN5O and a molecular weight of 427.90 g/mol. Its IUPAC name is 9-(3-chlorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | 9-(3-chlorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 3778846 |
| Molecular Formula | C24H18ClN5O |
| Molecular Weight | 427.90 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 9-(3-chlorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Cc1ccc2c(c1)C1=C(C(c3cccc(Cl)c3)O2)C(c2cccnc2)n2ncnc2N1 |
| InChI | InChI=1S/C24H18ClN5O/c1-14-7-8-19-18(10-14)21-20(23(31-19)15-4-2-6-17(25)11-15)22(16-5-3-9-26-12-16)30-24(29-21)27-13-28-30/h2-13,22-23H,1H3,(H,27,28,29) |
| InChIKey | LFLPEGFPVWIPBS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.90 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |