C24H18FN5O — CID 136900672
(9S,11S)-9-(3-fluorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 136900672) has the molecular formula C24H18FN5O and a molecular weight of 411.44 g/mol. Its IUPAC name is (9S,11S)-9-(3-fluorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9S,11S)-9-(3-fluorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 136900672 |
| Molecular Formula | C24H18FN5O |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | (9S,11S)-9-(3-fluorophenyl)-4-methyl-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Cc1ccc2c(c1)C1=C([C@H](c3cccc(F)c3)O2)[C@H](c2cccnc2)n2ncnc2N1 |
| InChI | InChI=1S/C24H18FN5O/c1-14-7-8-19-18(10-14)21-20(23(31-19)15-4-2-6-17(25)11-15)22(16-5-3-9-26-12-16)30-24(29-21)27-13-28-30/h2-13,22-23H,1H3,(H,27,28,29)/t22-,23-/m0/s1 |
| InChIKey | UXEAWPNKLSGIJV-GOTSBHOMSA-N |
| XLogP | 4.68 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |