C23H16FN5O — CID 2013133
(9R,11S)-9-(3-fluorophenyl)-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene (PubChem CID 2013133) has the molecular formula C23H16FN5O and a molecular weight of 397.41 g/mol. Its IUPAC name is (9R,11S)-9-(3-fluorophenyl)-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene.
| Compound Name | (9R,11S)-9-(3-fluorophenyl)-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
|---|---|
| PubChem CID | 2013133 |
| Molecular Formula | C23H16FN5O |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | (9R,11S)-9-(3-fluorophenyl)-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaene |
| SMILES | Fc1cccc([C@H]2Oc3ccccc3C3=C2[C@H](c2cccnc2)n2ncnc2N3)c1 |
| InChI | InChI=1S/C23H16FN5O/c24-16-7-3-5-14(11-16)22-19-20(17-8-1-2-9-18(17)30-22)28-23-26-13-27-29(23)21(19)15-6-4-10-25-12-15/h1-13,21-22H,(H,26,27,28)/t21-,22+/m0/s1 |
| InChIKey | XBMPPHPSJCEIJU-FCHUYYIVSA-N |
| XLogP | 4.37 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |