C25H18ClN5O3 — CID 3553956
methyl 4-(4-chloro-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl)benzoate (PubChem CID 3553956) has the molecular formula C25H18ClN5O3 and a molecular weight of 471.90 g/mol. Its IUPAC name is methyl 4-(4-chloro-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl)benzoate.
| Compound Name | methyl 4-(4-chloro-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl)benzoate |
|---|---|
| PubChem CID | 3553956 |
| Molecular Formula | C25H18ClN5O3 |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 471.11 |
| IUPAC Name | methyl 4-(4-chloro-11-pyridin-3-yl-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2Oc3ccc(Cl)cc3C3=C2C(c2cccnc2)n2ncnc2N3)cc1 |
| InChI | InChI=1S/C25H18ClN5O3/c1-33-24(32)15-6-4-14(5-7-15)23-20-21(18-11-17(26)8-9-19(18)34-23)30-25-28-13-29-31(25)22(20)16-3-2-10-27-12-16/h2-13,22-23H,1H3,(H,28,29,30) |
| InChIKey | FFGPKQYCWDKMLY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |