C27H21ClN4O3 — CID 3850524
methyl 4-[4-chloro-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate (PubChem CID 3850524) has the molecular formula C27H21ClN4O3 and a molecular weight of 484.94 g/mol. Its IUPAC name is methyl 4-[4-chloro-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate.
| Compound Name | methyl 4-[4-chloro-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate |
|---|---|
| PubChem CID | 3850524 |
| Molecular Formula | C27H21ClN4O3 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | methyl 4-[4-chloro-11-(4-methylphenyl)-8-oxa-12,13,15,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),2,4,6,13,15-hexaen-9-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2Oc3ccc(Cl)cc3C3=C2C(c2ccc(C)cc2)n2ncnc2N3)cc1 |
| InChI | InChI=1S/C27H21ClN4O3/c1-15-3-5-16(6-4-15)24-22-23(31-27-29-14-30-32(24)27)20-13-19(28)11-12-21(20)35-25(22)17-7-9-18(10-8-17)26(33)34-2/h3-14,24-25H,1-2H3,(H,29,30,31) |
| InChIKey | CWDIAJGVSMONCE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |