C19H17ClN4O3 — CID 3416943
7-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 3416943) has the molecular formula C19H17ClN4O3 and a molecular weight of 384.82 g/mol. Its IUPAC name is 7-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 7-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 3416943 |
| Molecular Formula | C19H17ClN4O3 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 7-[4-[2-(2-chlorophenoxy)ethoxy]phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | O=C1CC(c2ccc(OCCOc3ccccc3Cl)cc2)n2ncnc2N1 |
| InChI | InChI=1S/C19H17ClN4O3/c20-15-3-1-2-4-17(15)27-10-9-26-14-7-5-13(6-8-14)16-11-18(25)23-19-21-12-22-24(16)19/h1-8,12,16H,9-11H2,(H,21,22,23,25) |
| InChIKey | YNWPDKPEYHRRLK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|