C15H19N5O — CID 4237846
7-[4-(diethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 4237846) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 7-[4-(diethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | 7-[4-(diethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 4237846 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 7-[4-(diethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | CCN(CC)c1ccc(C2CC(=O)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C15H19N5O/c1-3-19(4-2)12-7-5-11(6-8-12)13-9-14(21)18-15-16-10-17-20(13)15/h5-8,10,13H,3-4,9H2,1-2H3,(H,16,17,18,21) |
| InChIKey | LRZGQHYDQQUAEW-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|