C20H25N5O — CID 135874762
(6R,9S)-9-[4-(diethylamino)phenyl]-6-methyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135874762) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is (6R,9S)-9-[4-(diethylamino)phenyl]-6-methyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9S)-9-[4-(diethylamino)phenyl]-6-methyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135874762 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | (6R,9S)-9-[4-(diethylamino)phenyl]-6-methyl-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCN(CC)c1ccc([C@H]2C3=C(C[C@@H](C)CC3=O)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C20H25N5O/c1-4-24(5-2)15-8-6-14(7-9-15)19-18-16(10-13(3)11-17(18)26)23-20-21-12-22-25(19)20/h6-9,12-13,19H,4-5,10-11H2,1-3H3,(H,21,22,23)/t13-,19+/m1/s1 |
| InChIKey | YLLFAILNWWSGEE-YJYMSZOUSA-N |
| XLogP | 3.39 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |