C19H20F3N5O — CID 135904524
(6R,9R)-9-[4-(dimethylamino)phenyl]-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135904524) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is (6R,9R)-9-[4-(dimethylamino)phenyl]-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6R,9R)-9-[4-(dimethylamino)phenyl]-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135904524 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | (6R,9R)-9-[4-(dimethylamino)phenyl]-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | C[C@H]1CC(=O)C2=C(C1)Nc1nc(C(F)(F)F)nn1[C@@H]2c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H20F3N5O/c1-10-8-13-15(14(28)9-10)16(11-4-6-12(7-5-11)26(2)3)27-18(23-13)24-17(25-27)19(20,21)22/h4-7,10,16H,8-9H2,1-3H3,(H,23,24,25)/t10-,16-/m1/s1 |
| InChIKey | PDHJRPQHFBAXFM-QLJPJBMISA-N |
| XLogP | 3.63 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |