C17H14F4N4O — CID 135904553
(6S,9S)-9-(3-fluorophenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 135904553) has the molecular formula C17H14F4N4O and a molecular weight of 366.32 g/mol. Its IUPAC name is (6S,9S)-9-(3-fluorophenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (6S,9S)-9-(3-fluorophenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 135904553 |
| Molecular Formula | C17H14F4N4O |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (6S,9S)-9-(3-fluorophenyl)-6-methyl-2-(trifluoromethyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | C[C@@H]1CC(=O)C2=C(C1)Nc1nc(C(F)(F)F)nn1[C@H]2c1cccc(F)c1 |
| InChI | InChI=1S/C17H14F4N4O/c1-8-5-11-13(12(26)6-8)14(9-3-2-4-10(18)7-9)25-16(22-11)23-15(24-25)17(19,20)21/h2-4,7-8,14H,5-6H2,1H3,(H,22,23,24)/t8-,14-/m0/s1 |
| InChIKey | PYSXDHGJROEYHX-RTHLEPHNSA-N |
| XLogP | 3.70 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |