C13H15N5O — CID 137094031
(7S)-7-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one (PubChem CID 137094031) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is (7S)-7-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one.
| Compound Name | (7S)-7-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 137094031 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | (7S)-7-[4-(dimethylamino)phenyl]-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidin-5-one |
| SMILES | CN(C)c1ccc([C@@H]2CC(=O)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C13H15N5O/c1-17(2)10-5-3-9(4-6-10)11-7-12(19)16-13-14-8-15-18(11)13/h3-6,8,11H,7H2,1-2H3,(H,14,15,16,19)/t11-/m0/s1 |
| InChIKey | MJLQSYHTAOCRHD-NSHDSACASA-N |
| XLogP | 1.28 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|