C12H10N6O4 — CID 135554753
(7S)-N-(3-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 135554753) has the molecular formula C12H10N6O4 and a molecular weight of 302.25 g/mol. Its IUPAC name is (7S)-N-(3-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | (7S)-N-(3-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 135554753 |
| Molecular Formula | C12H10N6O4 |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (7S)-N-(3-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2cccc([N+](=O)[O-])c2)n2ncnc2N1 |
| InChI | InChI=1S/C12H10N6O4/c19-10-5-9(17-12(16-10)13-6-14-17)11(20)15-7-2-1-3-8(4-7)18(21)22/h1-4,6,9H,5H2,(H,15,20)(H,13,14,16,19)/t9-/m0/s1 |
| InChIKey | DHHWXMPXUJKXSH-VIFPVBQESA-N |
| XLogP | 0.71 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|