C15H17N5O5 — CID 27518767
(4S)-2-morpholin-4-yl-N-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-4-carboxamide (PubChem CID 27518767) has the molecular formula C15H17N5O5 and a molecular weight of 347.33 g/mol. Its IUPAC name is (4S)-2-morpholin-4-yl-N-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-4-carboxamide.
| Compound Name | (4S)-2-morpholin-4-yl-N-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 27518767 |
| Molecular Formula | C15H17N5O5 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (4S)-2-morpholin-4-yl-N-(3-nitrophenyl)-6-oxo-4,5-dihydro-1H-pyrimidine-4-carboxamide |
| SMILES | O=C1C[C@@H](C(=O)Nc2cccc([N+](=O)[O-])c2)N=C(N2CCOCC2)N1 |
| InChI | InChI=1S/C15H17N5O5/c21-13-9-12(17-15(18-13)19-4-6-25-7-5-19)14(22)16-10-2-1-3-11(8-10)20(23)24/h1-3,8,12H,4-7,9H2,(H,16,22)(H,17,18,21)/t12-/m0/s1 |
| InChIKey | VSODOBQGTPBNBC-LBPRGKRZSA-N |
| XLogP | 0.11 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|