C13H12N6O4 — CID 135772343
(7R)-2-methyl-N-(4-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide (PubChem CID 135772343) has the molecular formula C13H12N6O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is (7R)-2-methyl-N-(4-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide.
| Compound Name | (7R)-2-methyl-N-(4-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 135772343 |
| Molecular Formula | C13H12N6O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (7R)-2-methyl-N-(4-nitrophenyl)-5-oxo-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-7-carboxamide |
| SMILES | Cc1nc2n(n1)[C@@H](C(=O)Nc1ccc([N+](=O)[O-])cc1)CC(=O)N2 |
| InChI | InChI=1S/C13H12N6O4/c1-7-14-13-16-11(20)6-10(18(13)17-7)12(21)15-8-2-4-9(5-3-8)19(22)23/h2-5,10H,6H2,1H3,(H,15,21)(H,14,16,17,20)/t10-/m1/s1 |
| InChIKey | XJPWFDMXVSPXNI-SNVBAGLBSA-N |
| XLogP | 1.02 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|