C14H19NO4 — CID 10378183
2,4,4,5,5-pentamethyl-2-(3-nitrophenyl)-1,3-dioxolane (PubChem CID 10378183) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 2,4,4,5,5-pentamethyl-2-(3-nitrophenyl)-1,3-dioxolane.
| Compound Name | 2,4,4,5,5-pentamethyl-2-(3-nitrophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 10378183 |
| Molecular Formula | C14H19NO4 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2,4,4,5,5-pentamethyl-2-(3-nitrophenyl)-1,3-dioxolane |
| SMILES | CC1(c2cccc([N+](=O)[O-])c2)OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H19NO4/c1-12(2)13(3,4)19-14(5,18-12)10-7-6-8-11(9-10)15(16)17/h6-9H,1-5H3 |
| InChIKey | CTGBEJIHQMICES-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|