C26H31N3O5 — CID 16748297
(1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-N-[[2-(3-nitrophenyl)-1,3-dioxolan-2-yl]methyl]-8-azabicyclo[3.2.1]octane-2-carboxamide (PubChem CID 16748297) has the molecular formula C26H31N3O5 and a molecular weight of 465.55 g/mol. Its IUPAC name is (1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-N-[[2-(3-nitrophenyl)-1,3-dioxolan-2-yl]methyl]-8-azabicyclo[3.2.1]octane-2-carboxamide.
| Compound Name | (1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-N-[[2-(3-nitrophenyl)-1,3-dioxolan-2-yl]methyl]-8-azabicyclo[3.2.1]octane-2-carboxamide |
|---|---|
| PubChem CID | 16748297 |
| Molecular Formula | C26H31N3O5 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-N-[[2-(3-nitrophenyl)-1,3-dioxolan-2-yl]methyl]-8-azabicyclo[3.2.1]octane-2-carboxamide |
| SMILES | Cc1ccc([C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)NCC2(c4cccc([N+](=O)[O-])c4)OCCO2)N3C)cc1 |
| InChI | InChI=1S/C26H31N3O5/c1-17-6-8-18(9-7-17)22-15-20-10-11-23(28(20)2)24(22)25(30)27-16-26(33-12-13-34-26)19-4-3-5-21(14-19)29(31)32/h3-9,14,20,22-24H,10-13,15-16H2,1-2H3,(H,27,30)/t20-,22+,23+,24-/m0/s1 |
| InChIKey | GFVYAXCKHHZGGQ-RBVMOCNTSA-N |
| XLogP | 3.49 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|