C22H21N5O8 — CID 43075752
ethyl 4-(furan-2-yl)-6-[[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 43075752) has the molecular formula C22H21N5O8 and a molecular weight of 483.44 g/mol. Its IUPAC name is ethyl 4-(furan-2-yl)-6-[[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(furan-2-yl)-6-[[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 43075752 |
| Molecular Formula | C22H21N5O8 |
| Molecular Weight | 483.44 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | ethyl 4-(furan-2-yl)-6-[[4-methyl-4-(3-nitrophenyl)-2,5-dioxoimidazolidin-1-yl]methyl]-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(CN2C(=O)NC(C)(c3cccc([N+](=O)[O-])c3)C2=O)NC(=O)NC1c1ccco1 |
| InChI | InChI=1S/C22H21N5O8/c1-3-34-18(28)16-14(23-20(30)24-17(16)15-8-5-9-35-15)11-26-19(29)22(2,25-21(26)31)12-6-4-7-13(10-12)27(32)33/h4-10,17H,3,11H2,1-2H3,(H,25,31)(H2,23,24,30) |
| InChIKey | KQDOZDUVCOJEGN-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 173.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|