C19H22N4O7 — CID 55402199
ethyl 6-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 55402199) has the molecular formula C19H22N4O7 and a molecular weight of 418.41 g/mol. Its IUPAC name is ethyl 6-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 6-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 55402199 |
| Molecular Formula | C19H22N4O7 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | ethyl 6-[(3-butyl-2,4,5-trioxoimidazolidin-1-yl)methyl]-4-(furan-2-yl)-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCCCN1C(=O)C(=O)N(CC2=C(C(=O)OCC)C(c3ccco3)NC(=O)N2)C1=O |
| InChI | InChI=1S/C19H22N4O7/c1-3-5-8-22-15(24)16(25)23(19(22)28)10-11-13(17(26)29-4-2)14(21-18(27)20-11)12-7-6-9-30-12/h6-7,9,14H,3-5,8,10H2,1-2H3,(H2,20,21,27) |
| InChIKey | FZICYEQMEQPAMH-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|