C25H27NO2 — CID 91373114
methyl (2S,3S)-8-methyl-3-[4-(3-phenylprop-1-ynyl)phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 91373114) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is methyl (2S,3S)-8-methyl-3-[4-(3-phenylprop-1-ynyl)phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (2S,3S)-8-methyl-3-[4-(3-phenylprop-1-ynyl)phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 91373114 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | methyl (2S,3S)-8-methyl-3-[4-(3-phenylprop-1-ynyl)phenyl]-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C2CCC(C[C@@H]1c1ccc(C#CCc3ccccc3)cc1)N2C |
| InChI | InChI=1S/C25H27NO2/c1-26-21-15-16-23(26)24(25(27)28-2)22(17-21)20-13-11-19(12-14-20)10-6-9-18-7-4-3-5-8-18/h3-5,7-8,11-14,21-24H,9,15-17H2,1-2H3/t21?,22-,23?,24+/m1/s1 |
| InChIKey | UQXSYPCRCBWDAJ-KTKPDYKZSA-N |
| XLogP | 4.02 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|