C17H23NO2 — CID 18756318
methyl 9-methyl-3-phenyl-9-azabicyclo[3.3.1]nonane-2-carboxylate (PubChem CID 18756318) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is methyl 9-methyl-3-phenyl-9-azabicyclo[3.3.1]nonane-2-carboxylate.
| Compound Name | methyl 9-methyl-3-phenyl-9-azabicyclo[3.3.1]nonane-2-carboxylate |
|---|---|
| PubChem CID | 18756318 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | methyl 9-methyl-3-phenyl-9-azabicyclo[3.3.1]nonane-2-carboxylate |
| SMILES | COC(=O)C1C(c2ccccc2)CC2CCCC1N2C |
| InChI | InChI=1S/C17H23NO2/c1-18-13-9-6-10-15(18)16(17(19)20-2)14(11-13)12-7-4-3-5-8-12/h3-5,7-8,13-16H,6,9-11H2,1-2H3 |
| InChIKey | BKQAVNYMOZGBMJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |