C16H20INO2 — CID 10249467
methyl (1R,2R,3S,5S)-3-(3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 10249467) has the molecular formula C16H20INO2 and a molecular weight of 385.25 g/mol. Its IUPAC name is methyl (1R,2R,3S,5S)-3-(3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | methyl (1R,2R,3S,5S)-3-(3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 10249467 |
| Molecular Formula | C16H20INO2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | methyl (1R,2R,3S,5S)-3-(3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2cccc(I)c2)C[C@@H]2CC[C@H]1N2C |
| InChI | InChI=1S/C16H20INO2/c1-18-12-6-7-14(18)15(16(19)20-2)13(9-12)10-4-3-5-11(17)8-10/h3-5,8,12-15H,6-7,9H2,1-2H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | XUBVUMLIQBPHGD-GBJTYRQASA-N |
| XLogP | 3.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|