C16H23Cl2IN2O2 — CID 86748390
methyl (1R,2S,3S,5S)-3-(4-amino-3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;dihydrochloride (PubChem CID 86748390) has the molecular formula C16H23Cl2IN2O2 and a molecular weight of 473.18 g/mol. Its IUPAC name is methyl (1R,2S,3S,5S)-3-(4-amino-3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;dihydrochloride.
| Compound Name | methyl (1R,2S,3S,5S)-3-(4-amino-3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 86748390 |
| Molecular Formula | C16H23Cl2IN2O2 |
| Molecular Weight | 473.18 g/mol |
| Exact Mass | 472.02 |
| IUPAC Name | methyl (1R,2S,3S,5S)-3-(4-amino-3-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;dihydrochloride |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccc(N)c(I)c2)C[C@@H]2CC[C@H]1N2C.Cl.Cl |
| InChI | InChI=1S/C16H21IN2O2.2ClH/c1-19-10-4-6-14(19)15(16(20)21-2)11(8-10)9-3-5-13(18)12(17)7-9;;/h3,5,7,10-11,14-15H,4,6,8,18H2,1-2H3;2*1H/t10-,11+,14+,15-;;/m0../s1 |
| InChIKey | QMKOAMMQLVMZFW-SIKNIWQISA-N |
| XLogP | 3.46 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.18 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|