C16H13N3O8S — CID 137229321
6-[(1,3-dioxo-1-phenylbutan-2-yl)diazenyl]-3-hydroxy-2-nitrobenzenesulfonic acid (PubChem CID 137229321) has the molecular formula C16H13N3O8S and a molecular weight of 407.36 g/mol. Its IUPAC name is 6-[(1,3-dioxo-1-phenylbutan-2-yl)diazenyl]-3-hydroxy-2-nitrobenzenesulfonic acid.
| Compound Name | 6-[(1,3-dioxo-1-phenylbutan-2-yl)diazenyl]-3-hydroxy-2-nitrobenzenesulfonic acid |
|---|---|
| PubChem CID | 137229321 |
| Molecular Formula | C16H13N3O8S |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | 6-[(1,3-dioxo-1-phenylbutan-2-yl)diazenyl]-3-hydroxy-2-nitrobenzenesulfonic acid |
| SMILES | CC(=O)C(/N=N/c1ccc(O)c([N+](=O)[O-])c1S(=O)(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13N3O8S/c1-9(20)13(15(22)10-5-3-2-4-6-10)18-17-11-7-8-12(21)14(19(23)24)16(11)28(25,26)27/h2-8,13,21H,1H3,(H,25,26,27)/b18-17+ |
| InChIKey | FPJQVGOGXOTXET-ISLYRVAYSA-N |
| XLogP | 2.47 |
| TPSA | 176.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|