C32H30CoN8O10S2 — CID 155293719
cobalt(2+);bis(2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxo-N-phenylbutanimidate) (PubChem CID 155293719) has the molecular formula C32H30CoN8O10S2 and a molecular weight of 809.71 g/mol. Its IUPAC name is cobalt(2+);bis(2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxo-N-phenylbutanimidate).
| Compound Name | cobalt(2+);bis(2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxo-N-phenylbutanimidate) |
|---|---|
| PubChem CID | 155293719 |
| Molecular Formula | C32H30CoN8O10S2 |
| Molecular Weight | 809.71 g/mol |
| Exact Mass | 809.09 |
| IUPAC Name | cobalt(2+);bis(2-[(2-hydroxy-5-sulfamoylphenyl)diazenyl]-3-oxo-N-phenylbutanimidate) |
| SMILES | CC(=O)C(/N=N/c1cc(S(N)(=O)=O)ccc1O)/C([O-])=N/c1ccccc1.CC(=O)C(/N=N/c1cc(S(N)(=O)=O)ccc1O)/C([O-])=N\c1ccccc1.[Co+2] |
| InChI | InChI=1S/2C16H16N4O5S.Co/c2*1-10(21)15(16(23)18-11-5-3-2-4-6-11)20-19-13-9-12(26(17,24)25)7-8-14(13)22;/h2*2-9,15,22H,1H3,(H,18,23)(H2,17,24,25);/q;;+2/p-2/b2*20-19+; |
| InChIKey | FCAYRSKJQANROE-FFRZOONGSA-L |
| XLogP | 2.34 |
| TPSA | 315.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.71 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|