C13H13N3O2S — CID 55159197
N'-(4-sulfamoylphenyl)benzenecarboximidamide (PubChem CID 55159197) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is N'-(4-sulfamoylphenyl)benzenecarboximidamide.
| Compound Name | N'-(4-sulfamoylphenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 55159197 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | N'-(4-sulfamoylphenyl)benzenecarboximidamide |
| SMILES | N/C(=N\c1ccc(S(N)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C13H13N3O2S/c14-13(10-4-2-1-3-5-10)16-11-6-8-12(9-7-11)19(15,17)18/h1-9H,(H2,14,16)(H2,15,17,18) |
| InChIKey | SHTXTMSKXGJZFZ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|