C7H10ClN3O3S — CID 24834739
N'-hydroxy-4-sulfamoylbenzenecarboximidamide;hydrochloride (PubChem CID 24834739) has the molecular formula C7H10ClN3O3S and a molecular weight of 251.69 g/mol. Its IUPAC name is N'-hydroxy-4-sulfamoylbenzenecarboximidamide;hydrochloride.
| Compound Name | N'-hydroxy-4-sulfamoylbenzenecarboximidamide;hydrochloride |
|---|---|
| PubChem CID | 24834739 |
| Molecular Formula | C7H10ClN3O3S |
| Molecular Weight | 251.69 g/mol |
| Exact Mass | 251.01 |
| IUPAC Name | N'-hydroxy-4-sulfamoylbenzenecarboximidamide;hydrochloride |
| SMILES | Cl.N/C(=N/O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C7H9N3O3S.ClH/c8-7(10-11)5-1-3-6(4-2-5)14(9,12)13;/h1-4,11H,(H2,8,10)(H2,9,12,13);1H |
| InChIKey | JESGJARNEDEHFR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.69 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|