C12H18N2O4S — CID 129391102
2,2-dimethylpropyl 4-(N'-hydroxycarbamimidoyl)benzenesulfonate (PubChem CID 129391102) has the molecular formula C12H18N2O4S and a molecular weight of 286.35 g/mol. Its IUPAC name is 2,2-dimethylpropyl 4-(N'-hydroxycarbamimidoyl)benzenesulfonate.
| Compound Name | 2,2-dimethylpropyl 4-(N'-hydroxycarbamimidoyl)benzenesulfonate |
|---|---|
| PubChem CID | 129391102 |
| Molecular Formula | C12H18N2O4S |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2,2-dimethylpropyl 4-(N'-hydroxycarbamimidoyl)benzenesulfonate |
| SMILES | CC(C)(C)COS(=O)(=O)c1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C12H18N2O4S/c1-12(2,3)8-18-19(16,17)10-6-4-9(5-7-10)11(13)14-15/h4-7,15H,8H2,1-3H3,(H2,13,14) |
| InChIKey | OSHYWCZLVIHBEF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|