C8H11N3O3S — CID 87540671
N'-hydroxy-4-(methylsulfamoyl)benzenecarboximidamide (PubChem CID 87540671) has the molecular formula C8H11N3O3S and a molecular weight of 229.26 g/mol. Its IUPAC name is N'-hydroxy-4-(methylsulfamoyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-(methylsulfamoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 87540671 |
| Molecular Formula | C8H11N3O3S |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | N'-hydroxy-4-(methylsulfamoyl)benzenecarboximidamide |
| SMILES | CNS(=O)(=O)c1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C8H11N3O3S/c1-10-15(13,14)7-4-2-6(3-5-7)8(9)11-12/h2-5,10,12H,1H3,(H2,9,11) |
| InChIKey | HNRINYYAKPVESE-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|