C8H8F3N3O2S — CID 152776148
N'-hydroxy-4-(trifluoromethylsulfonimidoyl)benzenecarboximidamide (PubChem CID 152776148) has the molecular formula C8H8F3N3O2S and a molecular weight of 267.23 g/mol. Its IUPAC name is N'-hydroxy-4-(trifluoromethylsulfonimidoyl)benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-(trifluoromethylsulfonimidoyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 152776148 |
| Molecular Formula | C8H8F3N3O2S |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N'-hydroxy-4-(trifluoromethylsulfonimidoyl)benzenecarboximidamide |
| SMILES | [H]N=S(=O)(c1ccc(/C(N)=N\O)cc1)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3O2S/c9-8(10,11)17(13,16)6-3-1-5(2-4-6)7(12)14-15/h1-4,13,15H,(H2,12,14) |
| InChIKey | VKGVJIQHEGWMBS-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|