C12H16N2O3S — CID 82501901
4-cyclopentylsulfonyl-N'-hydroxybenzenecarboximidamide (PubChem CID 82501901) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 4-cyclopentylsulfonyl-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-cyclopentylsulfonyl-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 82501901 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 4-cyclopentylsulfonyl-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(S(=O)(=O)C2CCCC2)cc1 |
| InChI | InChI=1S/C12H16N2O3S/c13-12(14-15)9-5-7-11(8-6-9)18(16,17)10-3-1-2-4-10/h5-8,10,15H,1-4H2,(H2,13,14) |
| InChIKey | IJJZHRXEEFFARV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|