C13H18ClN3O3S — CID 107810036
3-chloro-4-(cyclohexylsulfonylamino)-N'-hydroxybenzenecarboximidamide (PubChem CID 107810036) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is 3-chloro-4-(cyclohexylsulfonylamino)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-chloro-4-(cyclohexylsulfonylamino)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 107810036 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 3-chloro-4-(cyclohexylsulfonylamino)-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N/O)c1ccc(NS(=O)(=O)C2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O3S/c14-11-8-9(13(15)16-18)6-7-12(11)17-21(19,20)10-4-2-1-3-5-10/h6-8,10,17-18H,1-5H2,(H2,15,16) |
| InChIKey | QPSJFMXZKLVOKU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|