C9H13ClN4O3S — CID 114003616
3-chloro-4-(dimethylsulfamoylamino)-N'-hydroxybenzenecarboximidamide (PubChem CID 114003616) has the molecular formula C9H13ClN4O3S and a molecular weight of 292.75 g/mol. Its IUPAC name is 3-chloro-4-(dimethylsulfamoylamino)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-chloro-4-(dimethylsulfamoylamino)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 114003616 |
| Molecular Formula | C9H13ClN4O3S |
| Molecular Weight | 292.75 g/mol |
| Exact Mass | 292.04 |
| IUPAC Name | 3-chloro-4-(dimethylsulfamoylamino)-N'-hydroxybenzenecarboximidamide |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(/C(N)=N/O)cc1Cl |
| InChI | InChI=1S/C9H13ClN4O3S/c1-14(2)18(16,17)13-8-4-3-6(5-7(8)10)9(11)12-15/h3-5,13,15H,1-2H3,(H2,11,12) |
| InChIKey | NAZCNVNJCXBFKP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.75 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|