About 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride
4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride (PubChem CID 165349208) has the molecular formula C8H7ClN2O2
and a molecular weight of 198.61 g/mol. Its IUPAC name is 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride.
Molecular Properties
| Compound Name | 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride |
| PubChem CID | 165349208 |
| Molecular Formula | C8H7ClN2O2 |
| Molecular Weight | 198.61 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride |
| SMILES | N/C(=N\O)c1ccc(C(=O)Cl)cc1 |
| InChI | InChI=1S/C8H7ClN2O2/c9-7(12)5-1-3-6(4-2-5)8(10)11-13/h1-4,13H,(H2,10,11) |
| InChIKey | LQXDDNXJQZSHCM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.61 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride?
The IUPAC name of 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride (CID 165349208) is 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride.
What is the SMILES notation for 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride?
The canonical SMILES for 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride is N/C(=N\O)c1ccc(C(=O)Cl)cc1.
What is the InChIKey of 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride?
The InChIKey is LQXDDNXJQZSHCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O2/c9-7(12)5-1-3-6(4-2-5)8(10)11-13/h1-4,13H,(H2,10,11).
What are the key properties of 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride?
4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride has a molecular weight of 198.61 g/mol, XLogP of 1.16, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-N'-hydroxycarbamimidoyl]benzoyl chloride is sourced from PubChem (CID 165349208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).