C10H13N3O2 — CID 165437218
4-[(E)-N'-hydroxycarbamimidoyl]-N,N-dimethylbenzamide (PubChem CID 165437218) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 4-[(E)-N'-hydroxycarbamimidoyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[(E)-N'-hydroxycarbamimidoyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 165437218 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-[(E)-N'-hydroxycarbamimidoyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(/C(N)=N\O)cc1 |
| InChI | InChI=1S/C10H13N3O2/c1-13(2)10(14)8-5-3-7(4-6-8)9(11)12-15/h3-6,15H,1-2H3,(H2,11,12) |
| InChIKey | PXYRWOZJIBGESG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|