C16H17N3O2 — CID 76979478
N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N,2-dimethylbenzamide (PubChem CID 76979478) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N,2-dimethylbenzamide.
| Compound Name | N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 76979478 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | N-[4-(N'-hydroxycarbamimidoyl)phenyl]-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)c1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C16H17N3O2/c1-11-5-3-4-6-14(11)16(20)19(2)13-9-7-12(8-10-13)15(17)18-21/h3-10,21H,1-2H3,(H2,17,18) |
| InChIKey | PRLPQIMYFYRQMO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|