C16H16N2OS — CID 62969603
N-(4-carbamothioylphenyl)-N,2-dimethylbenzamide (PubChem CID 62969603) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-(4-carbamothioylphenyl)-N,2-dimethylbenzamide.
| Compound Name | N-(4-carbamothioylphenyl)-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 62969603 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-(4-carbamothioylphenyl)-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)c1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C16H16N2OS/c1-11-5-3-4-6-14(11)16(19)18(2)13-9-7-12(8-10-13)15(17)20/h3-10H,1-2H3,(H2,17,20) |
| InChIKey | MKFZSKSWYJXJPM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|