C22H30N2O — CID 151032584
N-[4-[(dipropylamino)methyl]phenyl]-N,2-dimethylbenzamide (PubChem CID 151032584) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is N-[4-[(dipropylamino)methyl]phenyl]-N,2-dimethylbenzamide.
| Compound Name | N-[4-[(dipropylamino)methyl]phenyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 151032584 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | N-[4-[(dipropylamino)methyl]phenyl]-N,2-dimethylbenzamide |
| SMILES | CCCN(CCC)Cc1ccc(N(C)C(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C22H30N2O/c1-5-15-24(16-6-2)17-19-11-13-20(14-12-19)23(4)22(25)21-10-8-7-9-18(21)3/h7-14H,5-6,15-17H2,1-4H3 |
| InChIKey | MAJLTTBFDJJFCO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |