C16H29NO — CID 142246396
N,2-dimethyl-N-propylbenzamide;ethane (PubChem CID 142246396) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is N,2-dimethyl-N-propylbenzamide;ethane.
| Compound Name | N,2-dimethyl-N-propylbenzamide;ethane |
|---|---|
| PubChem CID | 142246396 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | N,2-dimethyl-N-propylbenzamide;ethane |
| SMILES | CC.CC.CCCN(C)C(=O)c1ccccc1C |
| InChI | InChI=1S/C12H17NO.2C2H6/c1-4-9-13(3)12(14)11-8-6-5-7-10(11)2;2*1-2/h5-8H,4,9H2,1-3H3;2*1-2H3 |
| InChIKey | WEBYXLPOHCINPU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |