About N-iodo-N,2-dimethylbenzamide
N-iodo-N,2-dimethylbenzamide (PubChem CID 143099347) has the molecular formula C9H10INO
and a molecular weight of 275.09 g/mol. Its IUPAC name is N-iodo-N,2-dimethylbenzamide.
Molecular Properties
| Compound Name | N-iodo-N,2-dimethylbenzamide |
| PubChem CID | 143099347 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | N-iodo-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)I |
| InChI | InChI=1S/C9H10INO/c1-7-5-3-4-6-8(7)9(12)11(2)10/h3-6H,1-2H3 |
| InChIKey | SZNVOWSKYSEBAT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-iodo-N,2-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-iodo-N,2-dimethylbenzamide?
The IUPAC name of N-iodo-N,2-dimethylbenzamide (CID 143099347) is N-iodo-N,2-dimethylbenzamide.
What is the SMILES notation for N-iodo-N,2-dimethylbenzamide?
The canonical SMILES for N-iodo-N,2-dimethylbenzamide is Cc1ccccc1C(=O)N(C)I.
What is the InChIKey of N-iodo-N,2-dimethylbenzamide?
The InChIKey is SZNVOWSKYSEBAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10INO/c1-7-5-3-4-6-8(7)9(12)11(2)10/h3-6H,1-2H3.
What are the key properties of N-iodo-N,2-dimethylbenzamide?
N-iodo-N,2-dimethylbenzamide has a molecular weight of 275.09 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-iodo-N,2-dimethylbenzamide is sourced from PubChem (CID 143099347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).