C19H22N6O4 — CID 46945588
N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N'-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]pentanediamide (PubChem CID 46945588) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N'-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]pentanediamide.
| Compound Name | N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N'-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]pentanediamide |
|---|---|
| PubChem CID | 46945588 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-N'-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]pentanediamide |
| SMILES | N/C(=N\O)c1ccc(NC(=O)CCCC(=O)Nc2ccc(/C(N)=N\O)cc2)cc1 |
| InChI | InChI=1S/C19H22N6O4/c20-18(24-28)12-4-8-14(9-5-12)22-16(26)2-1-3-17(27)23-15-10-6-13(7-11-15)19(21)25-29/h4-11,28-29H,1-3H2,(H2,20,24)(H2,21,25)(H,22,26)(H,23,27) |
| InChIKey | CUJOKXLHJSVMQG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 175.42 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|