C10H13N3O3 — CID 61277576
N-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-methoxyacetamide (PubChem CID 61277576) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is N-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-methoxyacetamide.
| Compound Name | N-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 61277576 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-methoxyacetamide |
| SMILES | COCC(=O)Nc1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C10H13N3O3/c1-16-6-9(14)12-8-4-2-7(3-5-8)10(11)13-15/h2-5,15H,6H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | GHYURBOPHUCNEN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|