C18H27N5O4 — CID 91079732
ethyl 2-[4-[3-[4-(N'-hydroxycarbamimidoyl)anilino]-3-oxopropyl]piperazin-1-yl]acetate (PubChem CID 91079732) has the molecular formula C18H27N5O4 and a molecular weight of 377.45 g/mol. Its IUPAC name is ethyl 2-[4-[3-[4-(N'-hydroxycarbamimidoyl)anilino]-3-oxopropyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[3-[4-(N'-hydroxycarbamimidoyl)anilino]-3-oxopropyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 91079732 |
| Molecular Formula | C18H27N5O4 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | ethyl 2-[4-[3-[4-(N'-hydroxycarbamimidoyl)anilino]-3-oxopropyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CCC(=O)Nc2ccc(C(N)=NO)cc2)CC1 |
| InChI | InChI=1S/C18H27N5O4/c1-2-27-17(25)13-23-11-9-22(10-12-23)8-7-16(24)20-15-5-3-14(4-6-15)18(19)21-26/h3-6,26H,2,7-13H2,1H3,(H2,19,21)(H,20,24) |
| InChIKey | BCJWGIQUZFWDCL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|