C30H48N4O5 — CID 54358311
ethyl 2-[4-[3-[4-(N'-decoxycarbonylcarbamimidoyl)anilino]-3-oxopropyl]piperidin-1-yl]acetate (PubChem CID 54358311) has the molecular formula C30H48N4O5 and a molecular weight of 544.74 g/mol. Its IUPAC name is ethyl 2-[4-[3-[4-(N'-decoxycarbonylcarbamimidoyl)anilino]-3-oxopropyl]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[3-[4-(N'-decoxycarbonylcarbamimidoyl)anilino]-3-oxopropyl]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 54358311 |
| Molecular Formula | C30H48N4O5 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.36 |
| IUPAC Name | ethyl 2-[4-[3-[4-(N'-decoxycarbonylcarbamimidoyl)anilino]-3-oxopropyl]piperidin-1-yl]acetate |
| SMILES | CCCCCCCCCCOC(=O)N=C(N)c1ccc(NC(=O)CCC2CCN(CC(=O)OCC)CC2)cc1 |
| InChI | InChI=1S/C30H48N4O5/c1-3-5-6-7-8-9-10-11-22-39-30(37)33-29(31)25-13-15-26(16-14-25)32-27(35)17-12-24-18-20-34(21-19-24)23-28(36)38-4-2/h13-16,24H,3-12,17-23H2,1-2H3,(H,32,35)(H2,31,33,37) |
| InChIKey | UKRLVIZRVHHJGQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|