C26H33N3O4 — CID 16909723
butyl 4-[[1-[2-(4-methylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate (PubChem CID 16909723) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is butyl 4-[[1-[2-(4-methylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-[2-(4-methylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16909723 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | butyl 4-[[1-[2-(4-methylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCN(CC(=O)Nc3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C26H33N3O4/c1-3-4-17-33-26(32)21-7-11-23(12-8-21)28-25(31)20-13-15-29(16-14-20)18-24(30)27-22-9-5-19(2)6-10-22/h5-12,20H,3-4,13-18H2,1-2H3,(H,27,30)(H,28,31) |
| InChIKey | WOCFCEGNMHSVJB-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|