C21H30N2O4 — CID 31776506
butyl 4-[[1-(2-methylpropanoyl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 31776506) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is butyl 4-[[1-(2-methylpropanoyl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-(2-methylpropanoyl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 31776506 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | butyl 4-[[1-(2-methylpropanoyl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCN(C(=O)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C21H30N2O4/c1-4-5-14-27-21(26)17-6-8-18(9-7-17)22-19(24)16-10-12-23(13-11-16)20(25)15(2)3/h6-9,15-16H,4-5,10-14H2,1-3H3,(H,22,24) |
| InChIKey | GGFYJYOVLQLRNV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|