C24H34N2O6 — CID 31711351
[2-(4-butoxycarbonylanilino)-2-oxoethyl] 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate (PubChem CID 31711351) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is [2-(4-butoxycarbonylanilino)-2-oxoethyl] 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate.
| Compound Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31711351 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 1-(2,2-dimethylpropanoyl)piperidine-4-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)C2CCN(C(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C24H34N2O6/c1-5-6-15-31-21(28)17-7-9-19(10-8-17)25-20(27)16-32-22(29)18-11-13-26(14-12-18)23(30)24(2,3)4/h7-10,18H,5-6,11-16H2,1-4H3,(H,25,27) |
| InChIKey | SVGWEPLSMYQJPF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|