C17H23NO4 — CID 52709382
2-butoxyethyl 4-(cyclopropanecarbonylamino)benzoate (PubChem CID 52709382) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is 2-butoxyethyl 4-(cyclopropanecarbonylamino)benzoate.
| Compound Name | 2-butoxyethyl 4-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 52709382 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-butoxyethyl 4-(cyclopropanecarbonylamino)benzoate |
| SMILES | CCCCOCCOC(=O)c1ccc(NC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C17H23NO4/c1-2-3-10-21-11-12-22-17(20)14-6-8-15(9-7-14)18-16(19)13-4-5-13/h6-9,13H,2-5,10-12H2,1H3,(H,18,19) |
| InChIKey | XMQQLXZHOGJXQS-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|