C27H35N3O4 — CID 16910206
butyl 4-[[1-[2-(2,4-dimethylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate (PubChem CID 16910206) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is butyl 4-[[1-[2-(2,4-dimethylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-[2-(2,4-dimethylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 16910206 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | butyl 4-[[1-[2-(2,4-dimethylanilino)-2-oxoethyl]piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCN(CC(=O)Nc3ccc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C27H35N3O4/c1-4-5-16-34-27(33)22-7-9-23(10-8-22)28-26(32)21-12-14-30(15-13-21)18-25(31)29-24-11-6-19(2)17-20(24)3/h6-11,17,21H,4-5,12-16,18H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | YEBHJVPIFXXLME-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|