C24H27N3O3S — CID 90609345
butyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-4-carbonyl]amino]benzoate (PubChem CID 90609345) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is butyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-4-carbonyl]amino]benzoate.
| Compound Name | butyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 90609345 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | butyl 4-[[1-(1,3-benzothiazol-2-yl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)C2CCN(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O3S/c1-2-3-16-30-23(29)18-8-10-19(11-9-18)25-22(28)17-12-14-27(15-13-17)24-26-20-6-4-5-7-21(20)31-24/h4-11,17H,2-3,12-16H2,1H3,(H,25,28) |
| InChIKey | NQVQBLDNYBDMHK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|