C20H21N3OS — CID 90609323
1-(1,3-benzothiazol-2-yl)-N-(4-methylphenyl)piperidine-4-carboxamide (PubChem CID 90609323) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-N-(4-methylphenyl)piperidine-4-carboxamide.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-N-(4-methylphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90609323 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-N-(4-methylphenyl)piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(c3nc4ccccc4s3)CC2)cc1 |
| InChI | InChI=1S/C20H21N3OS/c1-14-6-8-16(9-7-14)21-19(24)15-10-12-23(13-11-15)20-22-17-4-2-3-5-18(17)25-20/h2-9,15H,10-13H2,1H3,(H,21,24) |
| InChIKey | BVYCIMCDGKCAAP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |